beta-Sitosterol (Compound)

Go to Compound classification

ID	1431
Name	beta-Sitosterol
Synonyms
Structure	MOL SDF 3D-SDF PDB SMILES InChI View 3D Structure Structure for EE001431 (beta-Sitosterol) 3D Structure for EE001431 (beta-Sitosterol) 222284 -OEChem-09232116083D 80 83 0 1 0 0 0 0 0999 V2000 8.4283 0.6445 -0.1446 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.2872 0.0123 0.1257 C 0 0 1 0 0 0 0 0 0 0 0 0 0.6661 -1.1090 0.5847 C 0 0 2 0 0 0 0 0 0 0 0 0 2.0573 -1.0191 -0.0507 C 0 0 1 0 0 0 0 0 0 0 0 0 2.6946 0.3603 0.2868 C 0 0 1 0 0 0 0 0 0 0 0 0 -1.5629 -0.4188 0.8897 C 0 0 2 0 0 0 0 0 0 0 0 0 0.3166 1.3472 0.5839 C 0 0 0 0 0 0 0 0 0 0 0 0 4.1197 0.5180 -0.3802 C 0 0 2 0 0 0 0 0 0 0 0 0 -0.1508 -2.3825 0.3886 C 0 0 0 0 0 0 0 0 0 0 0 0 1.7320 1.5493 0.0157 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.5947 -1.9550 0.7117 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9596 -2.1558 0.4526 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.8643 0.2524 0.4751 C 0 0 1 0 0 0 0 0 0 0 0 0 -0.5351 0.0425 -1.4030 C 0 0 0 0 0 0 0 0 0 0 0 0 4.9489 -0.7622 -0.2058 C 0 0 0 0 0 0 0 0 0 0 0 0 4.8561 1.7012 0.3164 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4124 -1.9334 0.1786 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0026 0.8086 -1.8959 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4322 -0.6661 -0.4787 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.0376 -0.3133 1.3029 C 0 0 0 0 0 0 0 0 0 0 0 0 6.3411 1.8086 -0.0274 C 0 0 0 0 0 0 0 0 0 0 0 0 7.0718 0.5030 0.2650 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.7406 1.7731 0.6174 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4119 0.3345 1.0658 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.0130 0.1702 -0.3544 C 0 0 2 0 0 0 0 0 0 0 0 0 -7.3512 0.9571 -0.5286 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.1390 -1.3295 -0.7206 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.1854 2.4548 -0.2412 C 0 0 0 0 0 0 0 0 0 0 0 0 -8.5123 0.4009 0.3000 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.6532 -1.5939 -2.1295 C 0 0 0 0 0 0 0 0 0 0 0 0 0.8136 -1.0087 1.6735 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9672 -1.1253 -1.1375 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8515 0.3581 1.3780 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4036 -0.2228 1.9617 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3699 1.3832 1.6796 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2615 2.2158 0.2718 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1827 -3.1891 1.0494 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.0823 -2.7486 -0.6419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.6465 1.7370 -1.0586 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1451 2.4647 0.4545 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.2573 -2.2670 -0.1037 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9450 -2.4429 1.6282 H 0 0 0 0 0 0 0 0 0 0 0 0 2.6516 -3.0945 -0.0237 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8391 -2.2953 1.5342 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0802 0.0298 -0.5765 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.1517 0.8977 -1.6956 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3921 0.1241 -1.9767 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.0434 -0.8588 -1.7605 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7706 1.5960 1.4065 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3763 2.6533 0.0602 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0548 -2.8015 0.3055 H 0 0 0 0 0 0 0 0 0 0 0 0 3.3961 0.0550 -2.4087 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5533 1.7885 -2.0865 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9777 0.8208 -2.3943 H 0 0 0 0 0 0 0 0 0 0 0 0 6.9544 -1.5905 -0.1999 H 0 0 0 0 0 0 0 0 0 0 0 0 6.6032 -0.5614 -1.5576 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.1226 -1.3958 1.1687 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8024 -0.1748 2.3677 H 0 0 0 0 0 0 0 0 0 0 0 0 6.4750 2.0909 -1.0790 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7975 2.6215 0.5509 H 0 0 0 0 0 0 0 0 0 0 0 0 7.0668 0.3133 1.3455 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1696 2.2064 -0.2044 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.3016 2.0625 1.5773 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7088 2.2738 0.5416 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3698 1.3861 1.3574 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.1020 -0.1285 1.7837 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3012 0.6155 -1.0628 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8822 -0.1928 0.0515 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6409 0.8845 -1.5847 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.1513 -1.7996 -0.6633 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7719 -1.8528 0.0049 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.3166 2.8620 -0.7684 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.0729 2.6604 0.8277 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.0683 3.0059 -0.5842 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.4262 0.9750 0.1096 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.3075 0.4563 1.3735 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.7293 -0.6401 0.0453 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.7023 -1.3048 -2.2378 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5830 -2.6622 -2.3593 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.0620 -1.0488 -2.8719 H 0 0 0 0 0 0 0 0 0 0 0 0 1 22 1 0 0 0 0 1 68 1 0 0 0 0 2 3 1 0 0 0 0 2 6 1 0 0 0 0 2 7 1 0 0 0 0 2 14 1 0 0 0 0 3 4 1 0 0 0 0 3 9 1 0 0 0 0 3 31 1 0 0 0 0 4 5 1 0 0 0 0 4 12 1 0 0 0 0 4 32 1 0 0 0 0 5 8 1 0 0 0 0 5 10 1 0 0 0 0 5 33 1 0 0 0 0 6 11 1 0 0 0 0 6 13 1 0 0 0 0 6 34 1 0 0 0 0 7 10 1 0 0 0 0 7 35 1 0 0 0 0 7 36 1 0 0 0 0 8 15 1 0 0 0 0 8 16 1 0 0 0 0 8 18 1 0 0 0 0 9 11 1 0 0 0 0 9 37 1 0 0 0 0 9 38 1 0 0 0 0 10 39 1 0 0 0 0 10 40 1 0 0 0 0 11 41 1 0 0 0 0 11 42 1 0 0 0 0 12 17 1 0 0 0 0 12 43 1 0 0 0 0 12 44 1 0 0 0 0 13 20 1 0 0 0 0 13 23 1 0 0 0 0 13 45 1 0 0 0 0 14 46 1 0 0 0 0 14 47 1 0 0 0 0 14 48 1 0 0 0 0 15 17 2 0 0 0 0 15 19 1 0 0 0 0 16 21 1 0 0 0 0 16 49 1 0 0 0 0 16 50 1 0 0 0 0 17 51 1 0 0 0 0 18 52 1 0 0 0 0 18 53 1 0 0 0 0 18 54 1 0 0 0 0 19 22 1 0 0 0 0 19 55 1 0 0 0 0 19 56 1 0 0 0 0 20 24 1 0 0 0 0 20 57 1 0 0 0 0 20 58 1 0 0 0 0 21 22 1 0 0 0 0 21 59 1 0 0 0 0 21 60 1 0 0 0 0 22 61 1 0 0 0 0 23 62 1 0 0 0 0 23 63 1 0 0 0 0 23 64 1 0 0 0 0 24 25 1 0 0 0 0 24 65 1 0 0 0 0 24 66 1 0 0 0 0 25 26 1 0 0 0 0 25 27 1 0 0 0 0 25 67 1 0 0 0 0 26 28 1 0 0 0 0 26 29 1 0 0 0 0 26 69 1 0 0 0 0 27 30 1 0 0 0 0 27 70 1 0 0 0 0 27 71 1 0 0 0 0 28 72 1 0 0 0 0 28 73 1 0 0 0 0 28 74 1 0 0 0 0 29 75 1 0 0 0 0 29 76 1 0 0 0 0 29 77 1 0 0 0 0 30 78 1 0 0 0 0 30 79 1 0 0 0 0 30 80 1 0 0 0 0 M END > <PUBCHEM_COMPOUND_CID> 222284 > <PUBCHEM_CONFORMER_RMSD> 1 > <PUBCHEM_CONFORMER_DIVERSEORDER> 1 7 8 4 9 6 2 3 5 > <PUBCHEM_MMFF94_PARTIAL_CHARGES> 9 1 -0.68 12 0.14 15 -0.28 17 -0.29 19 0.14 22 0.28 51 0.15 68 0.4 8 0.14 > <PUBCHEM_EFFECTIVE_ROTOR_COUNT> 8 > <PUBCHEM_PHARMACOPHORE_FEATURES> 10 1 1 acceptor 1 1 donor 1 23 hydrophobe 1 30 hydrophobe 3 26 28 29 hydrophobe 5 2 3 6 9 11 rings 6 13 20 24 25 26 27 hydrophobe 6 2 3 4 5 7 10 rings 6 4 5 8 12 15 17 rings 6 8 15 16 19 21 22 rings > <PUBCHEM_HEAVY_ATOM_COUNT> 30 > <PUBCHEM_ATOM_DEF_STEREO_COUNT> 9 > <PUBCHEM_ATOM_UDEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_DEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_UDEF_STEREO_COUNT> 0 > <PUBCHEM_ISOTOPIC_ATOM_COUNT> 0 > <PUBCHEM_COMPONENT_COUNT> 1 > <PUBCHEM_CACTVS_TAUTO_COUNT> 1 > <PUBCHEM_CONFORMER_ID> 0003644C00000001 > <PUBCHEM_MMFF94_ENERGY> 90.9091 > <PUBCHEM_FEATURE_SELFOVERLAP> 50.849 > <PUBCHEM_SHAPE_FINGERPRINT> 10 15 17894912962691494840 10076449 9 11383835982963215482 10411042 1 17832142720078186058 11135609 187 18410853248584332891 11135926 11 18259699000522354623 11315181 36 17632860837383960579 12082328 90 18409166619981770583 12236239 1 17989208144091680235 12838862 33 18337379509782536968 13533116 47 18342458102240903018 13690498 29 17987786524120535047 13782708 43 13542465341568485693 14117953 113 18261119573829353044 14251764 18 18343302578599469754 14251764 46 18259704502385562184 14856354 85 16343703249310428493 15131766 46 15794290607525213190 15142383 8 17240198846641461188 15183329 4 18060137631200354107 15352257 5 12103842359007724805 15439362 3 17982163732782906712 15461852 350 18202004364841154580 1577012 14 18411976954032003219 15849732 13 18260832609109029677 18681886 176 17917702539820496131 20105231 36 10159704616242060456 20157964 124 18410014308169195138 21150785 3 17490151919498884705 21298829 104 18334577940605644357 21792934 111 18335973174265083016 23559900 14 18339078314701993961 255183 451 17912371927388375470 2838139 119 18261111898427590197 335352 9 18410580587724291966 350125 39 18335420144953151713 3633792 109 18340491071152922336 4073 2 18113343033286644251 4325135 7 18272370863067426989 4760202 170 18340195333234445469 5104073 3 18189347787725460544 54039377 194 17917145131061195975 59755656 215 18334859398264945875 6009941 240 17385730222093131690 6086070 43 17632293527242487011 6328613 192 18411699885675543795 > <PUBCHEM_SHAPE_MULTIPOLES> 611.52 23.14 2.24 1.21 14.41 0.26 -0.49 -6.8 -4.35 0.18 0.08 1.18 0.2 -0.94 > <PUBCHEM_SHAPE_SELFOVERLAP> 1259.421 > <PUBCHEM_SHAPE_VOLUME> 351.6 > <PUBCHEM_COORDINATE_TYPE> 2 5 10 $$$$
Description
Classification	Compounds > Chemical entities > Organic compounds > Lipids and lipid-like molecules > Steroids and steroid derivatives > Stigmastanes and derivatives
CAS number	83-46-5
PubChem ID	222284
ChEBI ID	27693
FooDB ID	FDB012362
HMDB ID	HMDB0000852

Chemical data

MolDBi data

IUPAC Name	(1S,2R,5S,10S,11S,14R,15R)-14-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-5-ol
Traditional IUPAC Name	(1S,2R,5S,10S,11S,14R,15R)-14-[(2R,5R)-5-ethyl-6-methylheptan-2-yl]-2,15-dimethyltetracyclo[8.7.0.0^{2,7}.0^{11,15}]heptadec-7-en-5-ol
Formula	C29H50O
InChI	InChI=1S/C29H50O/c1-7-21(19(2)3)9-8-20(4)25-12-13-26-24-11-10-22-18-23(30)14-16-28(22,5)27(24)15-17-29(25,26)6/h10,19-21,23-27,30H,7-9,11-18H2,1-6H3/t20-,21-,23+,24+,25-,26+,27+,28+,29-/m1/s1
InChI Key	KZJWDPNRJALLNS-VJSFXXLFSA-N
Molecular weight	414.718
Exact mass	414.38616623
SMILES	[H][C@@]1(CC[C@@]2([H])[C@]3([H])CC=C4C[C@@H](O)CC[C@]4(C)[C@@]3([H])CC[C@]12C)[C@H](C)CC[C@@H](CC)C(C)C

ClassyFire Taxonomy

Description	belongs to the class of organic compounds known as stigmastanes and derivatives. These are sterol lipids with a structure based on the stigmastane skeleton, which consists of a cholestane moiety bearing an ethyl group at the carbon atom C24.
Kingdom	Organic compounds
Super Class	Lipids and lipid-like molecules
Class	Steroids and steroid derivatives
Sub Class	Stigmastanes and derivatives
Direct Parent	Stigmastanes and derivatives
Alternative Parents	Triterpenoids C24-propyl sterols and derivatives 3-beta-hydroxysteroids 3-beta-hydroxy delta-5-steroids Delta-5-steroids Secondary alcohols Cyclic alcohols and derivatives Hydrocarbon derivatives

Publications with beta-Sitosterol

ID	Title	First author	Authors	Year	Journal	Volume	Issue	Pages	PubMed ID	DOI	Study design	No. of Biomarkers	No. of Intake values	No. of Concentration values	No. of Reproducibility values	No. of Correlation values	No. of Metabolomic associations	No. of Microbiota associations	No. of Cancer associations

Biomarker data

Measurements of beta-Sitosterol in biospecimens

Concentration values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Reproducibility values

ID	Excretion ID	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Arithmetic mean	Geometric mean	Median	Unit	Adjusted on	Reproducibility size	ICC	ICC 95% CI lower	ICC 95% CI upper	CV% WS	CV% BS	VAR WS	VAR BS	Publication

Associations of beta-Sitosterol with exposures

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication

Metabolomic associations

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	Intake Assessment method	Intake	Intervention dose	Biospecimen	Analytical method	Biomarker	Structural identification	Feature selection	Area under curve	Sensitivity	Specificity	PLS-DA VIP	Beta coefficient	Beta coefficient p-value	ANOVA p-value	Publication

Microbiota associations

ID	Biomarker	Experimental evidence	Organism	Biospecimen	Antibiotic	Bacterial source	Substrate	Publication

Associations of beta-Sitosterol with cancer risk

Cancer associations

ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	No. of cases	No. of controls	Biospecimen	Analytical method	Biomarker	Biomarker detail	Cancer	Study design	Publication

Exposure data

Measurements of beta-Sitosterol exposures in populations

Intake values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Intake Time definition	Intake assessment tool	Intake food coverage	Intake time coverage	Intake Assessment method	Intake	Intake detail	Food description	Supplement intakes included?	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Associations of beta-Sitosterol exposures with biomarkers

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication