Stercobilinogen (Compound)

Go to Compound classification

ID	2521
Name	Stercobilinogen
Synonyms	L-Stercobilinogen; (-)-Stercobilinogen; L-Urobilinogen
Structure	MOL SDF 3D-SDF PDB SMILES InChI View 3D Structure Structure for EE002521 (Stercobilinogen) 3D Structure for EE002521 (Stercobilinogen) 9548718 -OEChem-12272222023D 91 94 0 1 0 0 0 0 0999 V2000 -2.0640 -6.0436 1.3465 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.1925 -0.7347 -1.8984 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0678 1.2786 0.2507 O 0 0 0 0 0 0 0 0 0 0 0 0 4.2109 0.8984 3.2097 O 0 0 0 0 0 0 0 0 0 0 0 0 7.0035 1.0295 -2.0039 O 0 0 0 0 0 0 0 0 0 0 0 0 4.4959 2.9726 2.3345 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.1469 -4.8651 0.7275 N 0 0 0 0 0 0 0 0 0 0 0 0 -3.6682 0.3979 -0.5415 N 0 0 0 0 0 0 0 0 0 0 0 0 0.8229 -0.8742 -1.5214 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.8005 2.0176 -1.2707 N 0 0 0 0 0 0 0 0 0 0 0 0 -0.9085 -2.6645 0.9975 C 0 0 1 0 0 0 0 0 0 0 0 0 0.2442 -3.5092 0.4345 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.1330 1.7676 0.6729 C 0 0 1 0 0 0 0 0 0 0 0 0 -3.6488 1.5172 0.3666 C 0 0 2 0 0 0 0 0 0 0 0 0 -2.1153 -3.6271 1.0651 C 0 0 2 0 0 0 0 0 0 0 0 0 -5.8991 1.1354 -0.5108 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4622 -3.3114 -1.0601 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9514 2.7187 -0.2581 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5602 -2.1485 2.3989 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4796 -5.0023 1.0853 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.9175 0.1326 -1.0819 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.3030 2.1435 -1.5777 C 0 0 0 0 0 0 0 0 0 0 0 0 1.3500 -2.1268 -1.3444 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5309 1.0874 1.9884 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4806 2.6018 -0.2342 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0581 -3.4999 -0.1235 C 0 0 0 0 0 0 0 0 0 0 0 0 1.8335 0.0192 -1.7639 C 0 0 0 0 0 0 0 0 0 0 0 0 2.7179 -2.0314 -1.4749 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5439 2.0347 -1.0054 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5561 2.9987 0.7065 C 0 0 0 0 0 0 0 0 0 0 0 0 1.5476 1.4488 -1.9914 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0237 -0.6737 -1.7405 C 0 0 0 0 0 0 0 0 0 0 0 0 0.7248 2.6398 0.2187 C 0 0 0 0 0 0 0 0 0 0 0 0 0.6236 -1.1986 2.3653 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.2889 3.1666 -1.0390 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3694 -0.1022 -1.9542 C 0 0 0 0 0 0 0 0 0 0 0 0 2.0182 2.8694 0.8951 C 0 0 0 0 0 0 0 0 0 0 0 0 3.6844 -3.1430 -1.3589 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.8505 3.6740 1.9875 C 0 0 0 0 0 0 0 0 0 0 0 0 5.0670 0.3884 -0.6695 C 0 0 0 0 0 0 0 0 0 0 0 0 2.4687 1.7206 1.8198 C 0 0 0 0 0 0 0 0 0 0 0 0 6.4587 0.9313 -0.9135 C 0 0 0 0 0 0 0 0 0 0 0 0 3.8148 1.9658 2.4673 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.1365 -1.7953 0.3699 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1917 -3.3665 0.9603 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3347 2.8344 0.8012 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1094 1.1976 1.2669 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.6838 -3.4872 1.9915 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7848 0.5898 -0.1633 H 0 0 0 0 0 0 0 0 0 0 0 0 0.9386 -4.2029 -1.4895 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4843 -3.1993 -1.5999 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2875 2.8752 -1.2905 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2313 3.6288 0.2879 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3433 -2.9765 3.0843 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4252 -1.6132 2.8098 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4895 -5.6536 0.6639 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.8411 -0.1417 -0.7770 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4328 2.6584 -1.9979 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.7714 1.6112 -2.4153 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3453 0.0082 1.9602 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.9628 1.5065 2.8258 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.5950 1.2436 2.1951 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.5710 -3.7489 -1.0703 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.9042 -4.1871 -0.0122 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.4583 -2.4856 -0.1940 H 0 0 0 0 0 0 0 0 0 0 0 0 2.4666 2.0434 -1.9419 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1605 1.5793 -3.0106 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1627 -0.6523 -1.4895 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2255 1.6298 -2.1021 H 0 0 0 0 0 0 0 0 0 0 0 0 0.4546 -0.4038 1.6331 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7447 -0.7277 3.3467 H 0 0 0 0 0 0 0 0 0 0 0 0 1.5687 -1.6941 2.1323 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8266 3.8562 -0.3281 H 0 0 0 0 0 0 0 0 0 0 0 0 -7.6807 3.7718 -1.8635 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.1389 2.6800 -0.5501 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0110 -0.8478 -2.4425 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3144 0.7282 -2.6704 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8011 3.0558 0.1490 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9686 3.7964 1.4816 H 0 0 0 0 0 0 0 0 0 0 0 0 4.6090 -2.8167 -0.8721 H 0 0 0 0 0 0 0 0 0 0 0 0 3.2831 -3.9694 -0.7638 H 0 0 0 0 0 0 0 0 0 0 0 0 3.9380 -3.5301 -2.3510 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1700 3.3421 2.7779 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.8681 3.4642 2.3323 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.7450 4.7580 1.8779 H 0 0 0 0 0 0 0 0 0 0 0 0 5.1396 -0.4335 0.0517 H 0 0 0 0 0 0 0 0 0 0 0 0 4.4763 1.1948 -0.2273 H 0 0 0 0 0 0 0 0 0 0 0 0 2.5379 0.7921 1.2438 H 0 0 0 0 0 0 0 0 0 0 0 0 1.7332 1.5858 2.6203 H 0 0 0 0 0 0 0 0 0 0 0 0 7.9759 1.6181 0.1008 H 0 0 0 0 0 0 0 0 0 0 0 0 5.0903 1.0446 3.6190 H 0 0 0 0 0 0 0 0 0 0 0 0 1 20 2 0 0 0 0 2 21 2 0 0 0 0 3 42 1 0 0 0 0 3 90 1 0 0 0 0 4 43 1 0 0 0 0 4 91 1 0 0 0 0 5 42 2 0 0 0 0 6 43 2 0 0 0 0 7 12 1 0 0 0 0 7 20 1 0 0 0 0 7 56 1 0 0 0 0 8 14 1 0 0 0 0 8 21 1 0 0 0 0 8 57 1 0 0 0 0 9 23 1 0 0 0 0 9 27 1 0 0 0 0 9 68 1 0 0 0 0 10 25 1 0 0 0 0 10 29 1 0 0 0 0 10 69 1 0 0 0 0 11 12 1 0 0 0 0 11 15 1 0 0 0 0 11 19 1 0 0 0 0 11 44 1 0 0 0 0 12 17 1 0 0 0 0 12 45 1 0 0 0 0 13 14 1 0 0 0 0 13 16 1 0 0 0 0 13 24 1 0 0 0 0 13 46 1 0 0 0 0 14 18 1 0 0 0 0 14 47 1 0 0 0 0 15 20 1 0 0 0 0 15 26 1 0 0 0 0 15 48 1 0 0 0 0 16 21 1 0 0 0 0 16 22 1 0 0 0 0 16 49 1 0 0 0 0 17 23 1 0 0 0 0 17 50 1 0 0 0 0 17 51 1 0 0 0 0 18 25 1 0 0 0 0 18 52 1 0 0 0 0 18 53 1 0 0 0 0 19 34 1 0 0 0 0 19 54 1 0 0 0 0 19 55 1 0 0 0 0 22 35 1 0 0 0 0 22 58 1 0 0 0 0 22 59 1 0 0 0 0 23 28 2 0 0 0 0 24 60 1 0 0 0 0 24 61 1 0 0 0 0 24 62 1 0 0 0 0 25 30 2 0 0 0 0 26 63 1 0 0 0 0 26 64 1 0 0 0 0 26 65 1 0 0 0 0 27 31 1 0 0 0 0 27 32 2 0 0 0 0 28 32 1 0 0 0 0 28 38 1 0 0 0 0 29 31 1 0 0 0 0 29 33 2 0 0 0 0 30 33 1 0 0 0 0 30 39 1 0 0 0 0 31 66 1 0 0 0 0 31 67 1 0 0 0 0 32 36 1 0 0 0 0 33 37 1 0 0 0 0 34 70 1 0 0 0 0 34 71 1 0 0 0 0 34 72 1 0 0 0 0 35 73 1 0 0 0 0 35 74 1 0 0 0 0 35 75 1 0 0 0 0 36 40 1 0 0 0 0 36 76 1 0 0 0 0 36 77 1 0 0 0 0 37 41 1 0 0 0 0 37 78 1 0 0 0 0 37 79 1 0 0 0 0 38 80 1 0 0 0 0 38 81 1 0 0 0 0 38 82 1 0 0 0 0 39 83 1 0 0 0 0 39 84 1 0 0 0 0 39 85 1 0 0 0 0 40 42 1 0 0 0 0 40 86 1 0 0 0 0 40 87 1 0 0 0 0 41 43 1 0 0 0 0 41 88 1 0 0 0 0 41 89 1 0 0 0 0 M END > <PUBCHEM_COMPOUND_CID> 9548718 > <PUBCHEM_CONFORMER_RMSD> 1.4 > <PUBCHEM_CONFORMER_DIVERSEORDER> 2 122 133 73 1 155 147 6 42 127 146 162 84 72 59 129 119 154 39 135 112 117 64 11 144 132 74 107 30 3 108 115 123 125 160 150 157 44 94 61 38 80 96 97 159 5 71 124 92 151 49 69 79 142 114 76 98 31 43 91 139 46 111 20 161 131 152 4 140 63 137 136 149 120 101 34 83 78 106 95 143 68 99 22 87 9 24 121 93 37 52 10 126 67 66 158 14 138 90 51 113 145 86 88 50 54 82 134 60 156 100 17 85 141 13 116 148 47 118 55 19 7 15 8 75 128 23 81 110 102 65 153 105 70 104 62 57 103 109 77 130 16 28 45 89 35 33 29 26 58 21 48 12 32 18 27 56 53 25 41 40 36 > <PUBCHEM_MMFF94_PARTIAL_CHARGES> 41 1 -0.57 10 0.03 12 0.3 14 0.3 15 0.06 16 0.06 17 0.18 18 0.18 2 -0.57 20 0.57 21 0.57 23 -0.33 25 -0.33 27 -0.33 28 -0.18 29 -0.33 3 -0.65 30 -0.18 31 0.36 32 -0.18 33 -0.18 36 0.18 37 0.18 38 0.18 39 0.18 4 -0.65 40 0.06 41 0.06 42 0.66 43 0.66 5 -0.57 56 0.37 57 0.37 6 -0.57 68 0.27 69 0.27 7 -0.73 8 -0.73 9 0.03 90 0.5 91 0.5 > <PUBCHEM_EFFECTIVE_ROTOR_COUNT> 15.6 > <PUBCHEM_PHARMACOPHORE_FEATURES> 20 1 1 acceptor 1 10 cation 1 10 donor 1 2 acceptor 1 3 acceptor 1 34 hydrophobe 1 35 hydrophobe 1 4 acceptor 1 5 acceptor 1 6 acceptor 1 7 donor 1 8 donor 1 9 cation 1 9 donor 3 3 5 42 anion 3 4 6 43 anion 5 10 25 29 30 33 rings 5 7 11 12 15 20 rings 5 8 13 14 16 21 rings 5 9 23 27 28 32 rings > <PUBCHEM_HEAVY_ATOM_COUNT> 43 > <PUBCHEM_ATOM_DEF_STEREO_COUNT> 6 > <PUBCHEM_ATOM_UDEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_DEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_UDEF_STEREO_COUNT> 0 > <PUBCHEM_ISOTOPIC_ATOM_COUNT> 0 > <PUBCHEM_COMPONENT_COUNT> 1 > <PUBCHEM_CACTVS_TAUTO_COUNT> 9 > <PUBCHEM_CONFORMER_ID> 0091B3AE00000002 > <PUBCHEM_MMFF94_ENERGY> 56.9442 > <PUBCHEM_FEATURE_SELFOVERLAP> 101.616 > <PUBCHEM_SHAPE_FINGERPRINT> 10032420 55 18196382415796573300 11170278 141 17902810873976278722 11285246 1 17406299649946052718 12156800 1 18261949777732254274 12597179 24 18343014536396575040 14040221 137 16552538092378437816 14040222 383 18408886257211341145 15351339 4 18409442558381704679 15975801 100 17676757739094351207 20587220 17 17404627322973177193 20764821 26 18120395373728272431 22223350 30 18408042926633499283 45266715 3 18340194216526156589 508706 21 18194683889522683831 6609424 69 17766018459327492318 86090 222 18343297050644634017 > <PUBCHEM_SHAPE_MULTIPOLES> 829.78 13.82 6.81 2.68 4.18 9.79 1.22 -12.32 -5.28 2.76 3.25 -2.02 -0.56 2.98 > <PUBCHEM_SHAPE_SELFOVERLAP> 1740.124 > <PUBCHEM_SHAPE_VOLUME> 474.7 > <PUBCHEM_COORDINATE_TYPE> 2 5 10 $$$$
Description	Bilirubin metabolite. Formed from I-Urobilinogen. Precursor of stercobilin.
Classification	Compounds > Chemical entities > Organic compounds > Organoheterocyclic compounds > Tetrapyrroles and derivatives > Bilirubins
CAS number	17095-63-5
PubChem ID	9548718
ChEBI ID	6320
FooDB ID	FDB023322
HMDB ID	HMDB0004157

Chemical data

MolDBi data

IUPAC Name	3-(2-{[3-(2-carboxyethyl)-5-{[(2S,3R,4R)-4-ethyl-3-methyl-5-oxopyrrolidin-2-yl]methyl}-4-methyl-1H-pyrrol-2-yl]methyl}-5-{[(2S,3R,4R)-3-ethyl-4-methyl-5-oxopyrrolidin-2-yl]methyl}-4-methyl-1H-pyrrol-3-yl)propanoic acid
Traditional IUPAC Name	(-)-stercobilinogen
Formula	C33H48N4O6
InChI	InChI=1S/C33H48N4O6/c1-7-20-19(6)32(42)37-27(20)14-25-18(5)23(10-12-31(40)41)29(35-25)15-28-22(9-11-30(38)39)17(4)24(34-28)13-26-16(3)21(8-2)33(43)36-26/h16,19-21,26-27,34-35H,7-15H2,1-6H3,(H,36,43)(H,37,42)(H,38,39)(H,40,41)/t16-,19-,20-,21-,26+,27+/m1/s1
InChI Key	VKGRRZVYCXLHII-OLFWPHQKSA-N
Molecular weight	596.769
Exact mass	596.357385282
SMILES	[H][C@@]1(CC2=C(C)C(CCC(O)=O)=C(CC3=C(CCC(O)=O)C(C)=C(C[C@]4([H])NC(=O)[C@H](C)[C@H]4CC)N3)N2)NC(=O)[C@H](CC)[C@H]1C

ClassyFire Taxonomy

Description	belongs to the class of organic compounds known as bilirubins. These are organic compounds containing a dicarboxylic acyclic tetrapyrrole derivative.
Kingdom	Organic compounds
Super Class	Organoheterocyclic compounds
Class	Tetrapyrroles and derivatives
Sub Class	Bilirubins
Direct Parent	Bilirubins
Alternative Parents	Substituted pyrroles Pyrrolidine-2-ones Dicarboxylic acids and derivatives Heteroaromatic compounds Secondary carboxylic acid amides Lactams Carboxylic acids Azacyclic compounds Organopnictogen compounds Organonitrogen compounds Organic oxides Hydrocarbon derivatives Carbonyl compounds

Publications with Stercobilinogen

ID	Title	First author	Authors	Year	Journal	Volume	Issue	Pages	PubMed ID	DOI	Study design	No. of Biomarkers	No. of Intake values	No. of Concentration values	No. of Reproducibility values	No. of Correlation values	No. of Metabolomic associations	No. of Microbiota associations	No. of Cancer associations

Biomarker data

Measurements of Stercobilinogen in biospecimens

Concentration values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Reproducibility values

ID	Excretion ID	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Arithmetic mean	Geometric mean	Median	Unit	Adjusted on	Reproducibility size	ICC	ICC 95% CI lower	ICC 95% CI upper	CV% WS	CV% BS	VAR WS	VAR BS	Publication

Associations of Stercobilinogen with exposures

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication

Metabolomic associations

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	Intake Assessment method	Intake	Intervention dose	Biospecimen	Analytical method	Biomarker	Structural identification	Feature selection	Area under curve	Sensitivity	Specificity	PLS-DA VIP	Beta coefficient	Beta coefficient p-value	ANOVA p-value	Publication

Microbiota associations

ID	Biomarker	Experimental evidence	Organism	Biospecimen	Antibiotic	Bacterial source	Substrate	Publication

Associations of Stercobilinogen with cancer risk

Cancer associations

ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	No. of cases	No. of controls	Biospecimen	Analytical method	Biomarker	Biomarker detail	Cancer	Study design	Publication

Exposure data

Measurements of Stercobilinogen exposures in populations

Intake values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Intake Time definition	Intake assessment tool	Intake food coverage	Intake time coverage	Intake Assessment method	Intake	Intake detail	Food description	Supplement intakes included?	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Associations of Stercobilinogen exposures with biomarkers

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication