11-Eicosenoic acid (cis-20:1n-9) (Compound)
Go to Compound classification| ID | 431 |
|---|---|
| Name | 11-Eicosenoic acid (cis-20:1n-9) |
| Synonyms | cis-11-Eicosenoic acid; Eicosenoic acid; Gondoic acid; 20:1n-9 |
| Structure |  |
| Description | |
| Classification | Compounds > Chemical entities > Organic compounds > Lipids and lipid-like molecules > Fatty Acyls > Fatty acids and conjugates > Long-chain fatty acids |
| CAS number | 5561-99-9 |
| PubChem ID | 5282768 |
| ChEBI ID | 32425 |
| FooDB ID | FDB012569 |
| HMDB ID | HMDB0002231 |
Chemical data
MolDBi data
| IUPAC Name | (11Z)-icos-11-enoic acid |
|---|---|
| Traditional IUPAC Name | cis-11-eicosenoic acid |
| Formula | C20H38O2 |
| InChI | InChI=1S/C20H38O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20(21)22/h9-10H,2-8,11-19H2,1H3,(H,21,22)/b10-9- |
| InChI Key | BITHHVVYSMSWAG-KTKRTIGZSA-N |
| Molecular weight | 310.5145 |
| Exact mass | 310.28718046 |
| SMILES | CCCCCCCC\C=C/CCCCCCCCCC(O)=O |
ClassyFire Taxonomy
| Description | belongs to the class of organic compounds known as long-chain fatty acids. These are fatty acids with an aliphatic tail that contains between 13 and 21 carbon atoms. |
|---|---|
| Kingdom | Organic compounds |
| Super Class | Lipids and lipid-like molecules |
| Class | Fatty Acyls |
| Sub Class | Fatty acids and conjugates |
| Direct Parent | Long-chain fatty acids |
| Alternative Parents |