Canthaxanthin (Compound)

Go to Compound classification

ID	442
Name	Canthaxanthin
Synonyms	Canthaxantin?
Structure	MOL SDF 3D-SDF PDB SMILES InChI View 3D Structure Structure for EE000442 (Canthaxanthin) 3D Structure for EE000442 (Canthaxanthin) 5281227 -OEChem-09032120363D 94 95 0 0 0 0 0 0 0999 V2000 13.1123 -2.9986 1.4257 O 0 0 0 0 0 0 0 0 0 0 0 0 -13.4315 2.5797 1.4180 O 0 0 0 0 0 0 0 0 0 0 0 0 12.8875 0.4824 -0.8823 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.8494 -0.8540 -0.8982 C 0 0 0 0 0 0 0 0 0 0 0 0 13.8631 -0.6788 -1.1845 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.9382 0.2023 -1.1990 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7265 -0.0094 0.0076 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.7458 -0.2485 -0.0055 C 0 0 0 0 0 0 0 0 0 0 0 0 14.2688 -1.4352 0.0615 C 0 0 0 0 0 0 0 0 0 0 0 0 -14.4205 0.9098 0.0484 C 0 0 0 0 0 0 0 0 0 0 0 0 13.6386 1.6253 -0.1656 C 0 0 0 0 0 0 0 0 0 0 0 0 12.4073 1.0005 -2.2615 C 0 0 0 0 0 0 0 0 0 0 0 0 -12.3171 -1.3168 -2.2780 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.4806 -2.0696 -0.1855 C 0 0 0 0 0 0 0 0 0 0 0 0 11.7848 -1.1392 0.7526 C 0 0 0 0 0 0 0 0 0 0 0 0 -11.9201 0.8673 0.7423 C 0 0 0 0 0 0 0 0 0 0 0 0 13.0512 -1.9519 0.7793 C 0 0 0 0 0 0 0 0 0 0 0 0 -13.2631 1.5464 0.7692 C 0 0 0 0 0 0 0 0 0 0 0 0 10.5443 0.8371 0.0034 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.4832 -0.9697 -0.0100 C 0 0 0 0 0 0 0 0 0 0 0 0 10.7017 -1.6935 1.6435 C 0 0 0 0 0 0 0 0 0 0 0 0 -10.9004 1.5271 1.6361 C 0 0 0 0 0 0 0 0 0 0 0 0 9.2937 0.3489 0.0018 C 0 0 0 0 0 0 0 0 0 0 0 0 -9.2876 -0.3582 -0.0086 C 0 0 0 0 0 0 0 0 0 0 0 0 8.0574 1.1313 -0.0083 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9800 -1.0145 -0.0092 C 0 0 0 0 0 0 0 0 0 0 0 0 8.1799 2.6355 -0.0539 C 0 0 0 0 0 0 0 0 0 0 0 0 -7.9604 -2.5259 -0.0028 C 0 0 0 0 0 0 0 0 0 0 0 0 6.8247 0.5799 -0.0095 C 0 0 0 0 0 0 0 0 0 0 0 0 -6.8008 -0.3558 -0.0077 C 0 0 0 0 0 0 0 0 0 0 0 0 5.5352 1.2419 -0.0190 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.4576 -0.9067 -0.0081 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3563 0.5977 -0.0193 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.3595 -0.1310 -0.0064 C 0 0 0 0 0 0 0 0 0 0 0 0 3.0218 1.2056 -0.0106 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.9708 -0.5920 -0.0101 C 0 0 0 0 0 0 0 0 0 0 0 0 1.9497 0.3843 -0.0124 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9112 0.2450 -0.0081 C 0 0 0 0 0 0 0 0 0 0 0 0 2.9490 2.7117 -0.0224 C 0 0 0 0 0 0 0 0 0 0 0 0 -2.7230 -2.0807 0.0173 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5475 0.7561 -0.0093 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.5006 -0.0855 -0.0113 C 0 0 0 0 0 0 0 0 0 0 0 0 13.3884 -1.3849 -1.8811 H 0 0 0 0 0 0 0 0 0 0 0 0 14.7627 -0.3055 -1.6903 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.5373 0.9550 -1.8931 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.7943 -0.2597 -1.7069 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8486 -0.8148 0.7517 H 0 0 0 0 0 0 0 0 0 0 0 0 14.8900 -2.2908 -0.2267 H 0 0 0 0 0 0 0 0 0 0 0 0 -15.1256 1.6983 -0.2386 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.9347 0.2316 0.7362 H 0 0 0 0 0 0 0 0 0 0 0 0 14.5351 1.9177 -0.7243 H 0 0 0 0 0 0 0 0 0 0 0 0 13.0140 2.5204 -0.0671 H 0 0 0 0 0 0 0 0 0 0 0 0 13.9545 1.3381 0.8433 H 0 0 0 0 0 0 0 0 0 0 0 0 13.2590 1.2461 -2.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8023 0.2477 -2.7805 H 0 0 0 0 0 0 0 0 0 0 0 0 11.8041 1.9109 -2.1729 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.6241 -2.1611 -2.1907 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.7916 -0.5048 -2.7942 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.1385 -1.6464 -2.9253 H 0 0 0 0 0 0 0 0 0 0 0 0 -13.8252 -1.8189 0.8237 H 0 0 0 0 0 0 0 0 0 0 0 0 -12.7680 -2.8965 -0.0885 H 0 0 0 0 0 0 0 0 0 0 0 0 -14.3420 -2.4505 -0.7462 H 0 0 0 0 0 0 0 0 0 0 0 0 10.7256 1.9068 0.0325 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.5564 -2.0522 0.0171 H 0 0 0 0 0 0 0 0 0 0 0 0 10.1013 -2.4347 1.1070 H 0 0 0 0 0 0 0 0 0 0 0 0 10.0534 -0.9222 2.0674 H 0 0 0 0 0 0 0 0 0 0 0 0 11.1283 -2.1905 2.5226 H 0 0 0 0 0 0 0 0 0 0 0 0 -11.3763 1.9759 2.5159 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.1771 0.8249 2.0587 H 0 0 0 0 0 0 0 0 0 0 0 0 -10.3781 2.3269 1.1020 H 0 0 0 0 0 0 0 0 0 0 0 0 9.1241 -0.7221 -0.0771 H 0 0 0 0 0 0 0 0 0 0 0 0 -9.2251 0.7242 -0.0882 H 0 0 0 0 0 0 0 0 0 0 0 0 8.8004 2.9358 -0.9071 H 0 0 0 0 0 0 0 0 0 0 0 0 7.2534 3.1977 -0.1620 H 0 0 0 0 0 0 0 0 0 0 0 0 8.6596 2.9988 0.8626 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4825 -2.9096 -0.8877 H 0 0 0 0 0 0 0 0 0 0 0 0 -8.4756 -2.9023 0.8892 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.9825 -3.0047 -0.0048 H 0 0 0 0 0 0 0 0 0 0 0 0 6.7650 -0.5092 0.0074 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.8402 0.7343 -0.0076 H 0 0 0 0 0 0 0 0 0 0 0 0 5.5221 2.3233 -0.0077 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.3345 -1.9804 -0.0146 H 0 0 0 0 0 0 0 0 0 0 0 0 4.3753 -0.4923 -0.0219 H 0 0 0 0 0 0 0 0 0 0 0 0 -4.4832 0.9516 -0.0041 H 0 0 0 0 0 0 0 0 0 0 0 0 2.1169 -0.6933 -0.0129 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.1119 1.3168 -0.0123 H 0 0 0 0 0 0 0 0 0 0 0 0 1.9311 3.1061 -0.0322 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4344 3.1259 0.8686 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4453 3.1135 -0.9130 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.2241 -2.5278 0.8844 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.6862 -2.4063 0.0851 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.1305 -2.5432 -0.8896 H 0 0 0 0 0 0 0 0 0 0 0 0 0.3198 1.8179 -0.0003 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.2380 -1.1377 -0.0248 H 0 0 0 0 0 0 0 0 0 0 0 0 1 17 2 0 0 0 0 2 18 2 0 0 0 0 3 5 1 0 0 0 0 3 7 1 0 0 0 0 3 11 1 0 0 0 0 3 12 1 0 0 0 0 4 6 1 0 0 0 0 4 8 1 0 0 0 0 4 13 1 0 0 0 0 4 14 1 0 0 0 0 5 9 1 0 0 0 0 5 43 1 0 0 0 0 5 44 1 0 0 0 0 6 10 1 0 0 0 0 6 45 1 0 0 0 0 6 46 1 0 0 0 0 7 15 2 0 0 0 0 7 19 1 0 0 0 0 8 16 2 0 0 0 0 8 20 1 0 0 0 0 9 17 1 0 0 0 0 9 47 1 0 0 0 0 9 48 1 0 0 0 0 10 18 1 0 0 0 0 10 49 1 0 0 0 0 10 50 1 0 0 0 0 11 51 1 0 0 0 0 11 52 1 0 0 0 0 11 53 1 0 0 0 0 12 54 1 0 0 0 0 12 55 1 0 0 0 0 12 56 1 0 0 0 0 13 57 1 0 0 0 0 13 58 1 0 0 0 0 13 59 1 0 0 0 0 14 60 1 0 0 0 0 14 61 1 0 0 0 0 14 62 1 0 0 0 0 15 17 1 0 0 0 0 15 21 1 0 0 0 0 16 18 1 0 0 0 0 16 22 1 0 0 0 0 19 23 2 0 0 0 0 19 63 1 0 0 0 0 20 24 2 0 0 0 0 20 64 1 0 0 0 0 21 65 1 0 0 0 0 21 66 1 0 0 0 0 21 67 1 0 0 0 0 22 68 1 0 0 0 0 22 69 1 0 0 0 0 22 70 1 0 0 0 0 23 25 1 0 0 0 0 23 71 1 0 0 0 0 24 26 1 0 0 0 0 24 72 1 0 0 0 0 25 27 1 0 0 0 0 25 29 2 0 0 0 0 26 28 1 0 0 0 0 26 30 2 0 0 0 0 27 73 1 0 0 0 0 27 74 1 0 0 0 0 27 75 1 0 0 0 0 28 76 1 0 0 0 0 28 77 1 0 0 0 0 28 78 1 0 0 0 0 29 31 1 0 0 0 0 29 79 1 0 0 0 0 30 32 1 0 0 0 0 30 80 1 0 0 0 0 31 33 2 0 0 0 0 31 81 1 0 0 0 0 32 34 2 0 0 0 0 32 82 1 0 0 0 0 33 35 1 0 0 0 0 33 83 1 0 0 0 0 34 36 1 0 0 0 0 34 84 1 0 0 0 0 35 37 2 0 0 0 0 35 39 1 0 0 0 0 36 38 2 0 0 0 0 36 40 1 0 0 0 0 37 41 1 0 0 0 0 37 85 1 0 0 0 0 38 42 1 0 0 0 0 38 86 1 0 0 0 0 39 87 1 0 0 0 0 39 88 1 0 0 0 0 39 89 1 0 0 0 0 40 90 1 0 0 0 0 40 91 1 0 0 0 0 40 92 1 0 0 0 0 41 42 2 0 0 0 0 41 93 1 0 0 0 0 42 94 1 0 0 0 0 M END > <PUBCHEM_COMPOUND_CID> 5281227 > <PUBCHEM_CONFORMER_RMSD> 1.2 > <PUBCHEM_CONFORMER_DIVERSEORDER> 1 47 9 25 36 4 2 38 13 21 3 29 46 11 42 18 39 23 35 17 40 26 8 16 48 5 30 37 22 6 24 28 20 33 31 44 43 45 12 27 41 14 15 34 19 32 7 10 > <PUBCHEM_MMFF94_PARTIAL_CHARGES> 50 1 -0.57 10 0.06 15 -0.12 16 -0.12 17 0.49 18 0.49 19 -0.15 2 -0.57 20 -0.15 21 0.14 22 0.14 23 -0.15 24 -0.15 25 -0.14 26 -0.14 27 0.14 28 0.14 29 -0.15 3 0.14 30 -0.15 31 -0.15 32 -0.15 33 -0.15 34 -0.15 35 -0.14 36 -0.14 37 -0.15 38 -0.15 39 0.14 4 0.14 40 0.14 41 -0.15 42 -0.15 63 0.15 64 0.15 7 -0.14 71 0.15 72 0.15 79 0.15 8 -0.14 80 0.15 81 0.15 82 0.15 83 0.15 84 0.15 85 0.15 86 0.15 9 0.06 93 0.15 94 0.15 > <PUBCHEM_EFFECTIVE_ROTOR_COUNT> 11.2 > <PUBCHEM_PHARMACOPHORE_FEATURES> 10 1 1 acceptor 1 2 acceptor 1 27 hydrophobe 1 28 hydrophobe 1 39 hydrophobe 1 40 hydrophobe 3 3 11 12 hydrophobe 3 4 13 14 hydrophobe 6 3 5 7 9 15 17 rings 6 4 6 8 10 16 18 rings > <PUBCHEM_HEAVY_ATOM_COUNT> 42 > <PUBCHEM_ATOM_DEF_STEREO_COUNT> 0 > <PUBCHEM_ATOM_UDEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_DEF_STEREO_COUNT> 9 > <PUBCHEM_BOND_UDEF_STEREO_COUNT> 0 > <PUBCHEM_ISOTOPIC_ATOM_COUNT> 0 > <PUBCHEM_COMPONENT_COUNT> 1 > <PUBCHEM_CACTVS_TAUTO_COUNT> 3 > <PUBCHEM_CONFORMER_ID> 005095CB00000001 > <PUBCHEM_MMFF94_ENERGY> 115.6982 > <PUBCHEM_FEATURE_SELFOVERLAP> 50.75 > <PUBCHEM_SHAPE_FINGERPRINT> 12013929 2 18259983798869563009 12559415 86 18040997323772505044 12559415 90 18202563990247802297 14251920 1 18410856568229730668 14251920 17 9943806690269597314 15061470 23 18343301504963719097 15219723 13 18335136462896488442 15343295 29 18412260620301761053 16728433 110 18271806874381474920 21026386 74 18262804103734785324 232437 2 18408885153605206054 3092352 35 18342737451905069383 3991529 128 11746934291909258288 57303763 39 11530772518393351153 9663363 56 15698282213442821553 > <PUBCHEM_SHAPE_MULTIPOLES> 852.6 99.01 2.39 1.22 7.06 0.15 -0.31 12.23 -4.88 -1.57 0.61 0 0.11 -6.34 > <PUBCHEM_SHAPE_SELFOVERLAP> 1742.769 > <PUBCHEM_SHAPE_VOLUME> 491.6 > <PUBCHEM_COORDINATE_TYPE> 2 5 10 $$$$
Description
Classification	Compounds > Chemical entities > Organic compounds > Lipids and lipid-like molecules > Prenol lipids > Tetraterpenoids > Carotenoids > Xanthophylls
CAS number	514-78-3
PubChem ID	5281227
ChEBI ID	3362
FooDB ID	FDB015890
HMDB ID	HMDB0003154

Chemical data

MolDBi data

IUPAC Name	2,4,4-trimethyl-3-[(1E,3E,5E,7E,9E,11E,13E,15E,17E)-3,7,12,16-tetramethyl-18-(2,6,6-trimethyl-3-oxocyclohex-1-en-1-yl)octadeca-1,3,5,7,9,11,13,15,17-nonaen-1-yl]cyclohex-2-en-1-one
Traditional IUPAC Name	canthaxanthin
Formula	C40H52O2
InChI	InChI=1S/C40H52O2/c1-29(17-13-19-31(3)21-23-35-33(5)37(41)25-27-39(35,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-36-34(6)38(42)26-28-40(36,9)10/h11-24H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+
InChI Key	FDSDTBUPSURDBL-DKLMTRRASA-N
Molecular weight	564.854
Exact mass	564.396730914
SMILES	C\C(\C=C\C=C(/C)\C=C\C1=C(C)C(=O)CCC1(C)C)=C/C=C/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C)C(=O)CCC1(C)C

ClassyFire Taxonomy

Description	belongs to the class of organic compounds known as xanthophylls. These are carotenoids containing an oxygenated carotene backbone. Carotenes are characterized by the presence of two end-groups (mostly cyclohexene rings, but also cyclopentene rings or acyclic groups) linked by a long branched alkyl chain. Carotenes belonging form a subgroup of the carotenoids family. Xanthophylls arise by oxygenation of the carotene backbone.
Kingdom	Organic compounds
Super Class	Lipids and lipid-like molecules
Class	Prenol lipids
Sub Class	Tetraterpenoids
Direct Parent	Xanthophylls
Alternative Parents	Cyclohexenones Organic oxides Hydrocarbon derivatives

Publications with Canthaxanthin

ID	Title	First author	Authors	Year	Journal	Volume	Issue	Pages	PubMed ID	DOI	Study design	No. of Biomarkers	No. of Intake values	No. of Concentration values	No. of Reproducibility values	No. of Correlation values	No. of Metabolomic associations	No. of Microbiota associations	No. of Cancer associations

Biomarker data

Measurements of Canthaxanthin in biospecimens

Concentration values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Reproducibility values

ID	Excretion ID	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Arithmetic mean	Geometric mean	Median	Unit	Adjusted on	Reproducibility size	ICC	ICC 95% CI lower	ICC 95% CI upper	CV% WS	CV% BS	VAR WS	VAR BS	Publication

Associations of Canthaxanthin with exposures

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication

Metabolomic associations

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	Intake Assessment method	Intake	Intervention dose	Biospecimen	Analytical method	Biomarker	Structural identification	Feature selection	Area under curve	Sensitivity	Specificity	PLS-DA VIP	Beta coefficient	Beta coefficient p-value	ANOVA p-value	Publication

Microbiota associations

ID	Biomarker	Experimental evidence	Organism	Biospecimen	Antibiotic	Bacterial source	Substrate	Publication

Associations of Canthaxanthin with cancer risk

Cancer associations

ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	No. of cases	No. of controls	Biospecimen	Analytical method	Biomarker	Biomarker detail	Cancer	Study design	Publication

Exposure data

Measurements of Canthaxanthin exposures in populations

Intake values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Intake Time definition	Intake assessment tool	Intake food coverage	Intake time coverage	Intake Assessment method	Intake	Intake detail	Food description	Supplement intakes included?	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Associations of Canthaxanthin exposures with biomarkers

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication