beta-Tocopherol (Compound)

Go to Compound classification

ID	872
Name	beta-Tocopherol
Synonyms	(+)-beta-Tocopherol; D-beta-Tocopherol
Structure	MOL SDF 3D-SDF PDB SMILES InChI View 3D Structure Structure for EE000872 (beta-Tocopherol) 3D Structure for EE000872 (beta-Tocopherol) 6857447 -OEChem-09032121153D 78 79 0 1 0 0 0 0 0999 V2000 -0.8808 1.3268 -0.1843 O 0 0 0 0 0 0 0 0 0 0 0 0 -5.2994 -1.5632 -1.7998 O 0 0 0 0 0 0 0 0 0 0 0 0 -0.9779 2.2669 0.9022 C 0 0 2 0 0 0 0 0 0 0 0 0 0.4544 2.4549 1.4239 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.8546 1.7288 2.0447 C 0 0 0 0 0 0 0 0 0 0 0 0 1.4632 2.5450 0.2773 C 0 0 0 0 0 0 0 0 0 0 0 0 3.9690 2.7900 -0.2906 C 0 0 1 0 0 0 0 0 0 0 0 0 2.8836 2.7654 0.8088 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.2530 1.3801 1.5547 C 0 0 0 0 0 0 0 0 0 0 0 0 4.0330 1.4541 -1.0616 C 0 0 0 0 0 0 0 0 0 0 0 0 4.3205 0.2398 -0.1714 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.4775 3.6122 0.3540 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.1734 0.6085 0.2710 C 0 0 0 0 0 0 0 0 0 0 0 0 4.4031 -1.0826 -0.9469 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6244 -2.3621 -0.1068 C 0 0 1 0 0 0 0 0 0 0 0 0 -2.0150 0.6329 -0.5145 C 0 0 0 0 0 0 0 0 0 0 0 0 3.5651 -2.5038 1.0064 C 0 0 0 0 0 0 0 0 0 0 0 0 3.7017 3.9762 -1.2245 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2830 -0.1249 -0.1705 C 0 0 0 0 0 0 0 0 0 0 0 0 2.1072 -2.5900 0.5355 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.9584 -0.0960 -1.7060 C 0 0 0 0 0 0 0 0 0 0 0 0 4.6215 -3.5740 -1.0475 C 0 0 0 0 0 0 0 0 0 0 0 0 1.0556 -2.6740 1.6487 C 0 0 0 0 0 0 0 0 0 0 0 0 -4.2270 -0.8438 -1.3648 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.4125 -2.6788 1.1821 C 0 0 0 0 0 0 0 0 0 0 0 0 -3.0637 -0.8322 -2.1304 C 0 0 0 0 0 0 0 0 0 0 0 0 -5.5476 -0.1584 0.6312 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.7208 -0.1093 -2.5437 C 0 0 0 0 0 0 0 0 0 0 0 0 -1.3967 -2.7051 2.3517 C 0 0 0 0 0 0 0 0 0 0 0 0 -0.6612 -3.8834 0.2707 C 0 0 0 0 0 0 0 0 0 0 0 0 0.5205 3.3338 2.0768 H 0 0 0 0 0 0 0 0 0 0 0 0 0.7384 1.5874 2.0352 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.9147 2.4468 2.8711 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4011 0.8118 2.4467 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1953 3.3636 -0.3950 H 0 0 0 0 0 0 0 0 0 0 0 0 1.4410 1.6172 -0.3010 H 0 0 0 0 0 0 0 0 0 0 0 0 4.9372 2.9562 0.1992 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1258 2.0070 1.5614 H 0 0 0 0 0 0 0 0 0 0 0 0 2.9107 3.7224 1.3473 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.8400 2.2919 1.3963 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.7457 0.7942 2.3388 H 0 0 0 0 0 0 0 0 0 0 0 0 4.8343 1.5299 -1.8086 H 0 0 0 0 0 0 0 0 0 0 0 0 3.1129 1.2880 -1.6333 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5204 0.1548 0.5673 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2563 0.3964 0.3777 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8698 3.9651 -0.4848 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4934 3.5324 -0.0468 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.4831 4.3843 1.1306 H 0 0 0 0 0 0 0 0 0 0 0 0 3.4949 -1.1908 -1.5536 H 0 0 0 0 0 0 0 0 0 0 0 0 5.2280 -1.0006 -1.6676 H 0 0 0 0 0 0 0 0 0 0 0 0 5.6096 -2.2991 0.3723 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7908 -3.4135 1.5791 H 0 0 0 0 0 0 0 0 0 0 0 0 3.6681 -1.6816 1.7239 H 0 0 0 0 0 0 0 0 0 0 0 0 2.8152 3.8219 -1.8470 H 0 0 0 0 0 0 0 0 0 0 0 0 3.5765 4.9069 -0.6614 H 0 0 0 0 0 0 0 0 0 0 0 0 4.5504 4.1132 -1.9038 H 0 0 0 0 0 0 0 0 0 0 0 0 1.8670 -1.7168 -0.0808 H 0 0 0 0 0 0 0 0 0 0 0 0 2.0088 -3.4696 -0.1081 H 0 0 0 0 0 0 0 0 0 0 0 0 3.7006 -3.6387 -1.6354 H 0 0 0 0 0 0 0 0 0 0 0 0 4.7331 -4.5045 -0.4811 H 0 0 0 0 0 0 0 0 0 0 0 0 5.4584 -3.5117 -1.7517 H 0 0 0 0 0 0 0 0 0 0 0 0 1.2506 -3.5709 2.2508 H 0 0 0 0 0 0 0 0 0 0 0 0 1.1996 -1.8179 2.3208 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.5961 -1.7655 0.6061 H 0 0 0 0 0 0 0 0 0 0 0 0 -3.0200 -1.3976 -3.0582 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.4185 -0.7997 1.5093 H 0 0 0 0 0 0 0 0 0 0 0 0 -6.4028 -0.5390 0.0639 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.8316 0.8477 0.9577 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.4619 0.9073 -2.8581 H 0 0 0 0 0 0 0 0 0 0 0 0 0.1154 -0.5350 -1.9788 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.8447 -0.7108 -3.4505 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2738 -3.6116 2.9538 H 0 0 0 0 0 0 0 0 0 0 0 0 -2.4308 -2.6708 1.9928 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.2411 -1.8406 3.0053 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.3783 -4.8218 0.7595 H 0 0 0 0 0 0 0 0 0 0 0 0 -0.1049 -3.7998 -0.6678 H 0 0 0 0 0 0 0 0 0 0 0 0 -1.7216 -3.9506 0.0028 H 0 0 0 0 0 0 0 0 0 0 0 0 -5.0745 -1.9932 -2.6426 H 0 0 0 0 0 0 0 0 0 0 0 0 1 3 1 0 0 0 0 1 16 1 0 0 0 0 2 24 1 0 0 0 0 2 78 1 0 0 0 0 3 4 1 0 0 0 0 3 5 1 0 0 0 0 3 12 1 0 0 0 0 4 6 1 0 0 0 0 4 31 1 0 0 0 0 4 32 1 0 0 0 0 5 9 1 0 0 0 0 5 33 1 0 0 0 0 5 34 1 0 0 0 0 6 8 1 0 0 0 0 6 35 1 0 0 0 0 6 36 1 0 0 0 0 7 8 1 0 0 0 0 7 10 1 0 0 0 0 7 18 1 0 0 0 0 7 37 1 0 0 0 0 8 38 1 0 0 0 0 8 39 1 0 0 0 0 9 13 1 0 0 0 0 9 40 1 0 0 0 0 9 41 1 0 0 0 0 10 11 1 0 0 0 0 10 42 1 0 0 0 0 10 43 1 0 0 0 0 11 14 1 0 0 0 0 11 44 1 0 0 0 0 11 45 1 0 0 0 0 12 46 1 0 0 0 0 12 47 1 0 0 0 0 12 48 1 0 0 0 0 13 16 2 0 0 0 0 13 19 1 0 0 0 0 14 15 1 0 0 0 0 14 49 1 0 0 0 0 14 50 1 0 0 0 0 15 17 1 0 0 0 0 15 22 1 0 0 0 0 15 51 1 0 0 0 0 16 21 1 0 0 0 0 17 20 1 0 0 0 0 17 52 1 0 0 0 0 17 53 1 0 0 0 0 18 54 1 0 0 0 0 18 55 1 0 0 0 0 18 56 1 0 0 0 0 19 24 2 0 0 0 0 19 27 1 0 0 0 0 20 23 1 0 0 0 0 20 57 1 0 0 0 0 20 58 1 0 0 0 0 21 26 2 0 0 0 0 21 28 1 0 0 0 0 22 59 1 0 0 0 0 22 60 1 0 0 0 0 22 61 1 0 0 0 0 23 25 1 0 0 0 0 23 62 1 0 0 0 0 23 63 1 0 0 0 0 24 26 1 0 0 0 0 25 29 1 0 0 0 0 25 30 1 0 0 0 0 25 64 1 0 0 0 0 26 65 1 0 0 0 0 27 66 1 0 0 0 0 27 67 1 0 0 0 0 27 68 1 0 0 0 0 28 69 1 0 0 0 0 28 70 1 0 0 0 0 28 71 1 0 0 0 0 29 72 1 0 0 0 0 29 73 1 0 0 0 0 29 74 1 0 0 0 0 30 75 1 0 0 0 0 30 76 1 0 0 0 0 30 77 1 0 0 0 0 M END > <PUBCHEM_COMPOUND_CID> 6857447 > <PUBCHEM_CONFORMER_RMSD> 1.6 > <PUBCHEM_CONFORMER_DIVERSEORDER> 8 75 60 1 15 68 71 84 16 50 43 63 66 87 76 25 6 11 72 46 81 13 74 78 7 51 3 26 9 52 83 20 53 64 88 33 79 12 82 2 21 22 49 27 59 45 89 86 73 67 41 34 77 85 47 39 18 57 69 40 42 44 62 55 10 58 19 61 4 36 24 32 23 38 70 35 14 54 80 31 5 37 30 48 17 65 28 56 29 > <PUBCHEM_MMFF94_PARTIAL_CHARGES> 14 1 -0.36 13 -0.14 16 0.08 19 -0.14 2 -0.53 21 -0.14 24 0.08 26 -0.15 27 0.14 28 0.14 3 0.28 65 0.15 78 0.45 9 0.14 > <PUBCHEM_EFFECTIVE_ROTOR_COUNT> 12.8 > <PUBCHEM_PHARMACOPHORE_FEATURES> 7 1 1 acceptor 1 18 hydrophobe 1 2 donor 1 22 hydrophobe 3 25 29 30 hydrophobe 6 1 3 5 9 13 16 rings 6 13 16 19 21 24 26 rings > <PUBCHEM_HEAVY_ATOM_COUNT> 30 > <PUBCHEM_ATOM_DEF_STEREO_COUNT> 3 > <PUBCHEM_ATOM_UDEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_DEF_STEREO_COUNT> 0 > <PUBCHEM_BOND_UDEF_STEREO_COUNT> 0 > <PUBCHEM_ISOTOPIC_ATOM_COUNT> 0 > <PUBCHEM_COMPONENT_COUNT> 1 > <PUBCHEM_CACTVS_TAUTO_COUNT> 9 > <PUBCHEM_CONFORMER_ID> 0068A2E700000008 > <PUBCHEM_MMFF94_ENERGY> 66.3495 > <PUBCHEM_FEATURE_SELFOVERLAP> 35.549 > <PUBCHEM_SHAPE_FINGERPRINT> 12107698 1 18272089336509242502 12539773 59 17844819083337138520 12788726 201 17774739617875893265 13383661 66 16898756789046840047 14040221 97 17462864390387007493 14279260 333 17761219813386969214 14931854 50 18408890607802352462 15264996 163 18048321042329834380 15403338 16 18339640040800440167 19319366 153 18055348291715399828 20764821 26 18194117645571719050 20775438 99 17983267577367825174 21304303 94 18265882730323824058 21857420 4 15832478836190405630 25265897 201 12109208937538811032 392239 28 18336841843811288947 437795 51 18261115197221027563 4409770 3 17401488647072992832 463206 1 18342173431623803792 5265222 85 17396711246789441005 9981440 41 15468847449226340865 > <PUBCHEM_SHAPE_MULTIPOLES> 605.65 10.49 5.48 2.14 0.85 0.02 -0.34 -2.42 -3.57 6.11 1.36 -1.62 -0.59 -1.36 > <PUBCHEM_SHAPE_SELFOVERLAP> 1212.27 > <PUBCHEM_SHAPE_VOLUME> 359.4 > <PUBCHEM_COORDINATE_TYPE> 2 5 10 $$$$
Description
Classification	Compounds > Chemical entities > Organic compounds > Lipids and lipid-like molecules > Prenol lipids > Quinone and hydroquinone lipids > Vitamin E compounds > Tocopherols
CAS number	148-03-8
PubChem ID	6857447
ChEBI ID	47771
FooDB ID	FDB012381
HMDB ID	HMDB0006335

Chemical data

MolDBi data

IUPAC Name	(2R)-2,5,8-trimethyl-2-[(4R,8R)-4,8,12-trimethyltridecyl]-3,4-dihydro-2H-1-benzopyran-6-ol
Traditional IUPAC Name	β-tocopherol
Formula	C28H48O2
InChI	InChI=1S/C28H48O2/c1-20(2)11-8-12-21(3)13-9-14-22(4)15-10-17-28(7)18-16-25-24(6)26(29)19-23(5)27(25)30-28/h19-22,29H,8-18H2,1-7H3/t21-,22-,28-/m1/s1
InChI Key	WGVKWNUPNGFDFJ-DQCZWYHMSA-N
Molecular weight	416.6795
Exact mass	416.36543078
SMILES	CC(C)CCC[C@@H](C)CCC[C@@H](C)CCC[C@]1(C)CCC2=C(O1)C(C)=CC(O)=C2C

ClassyFire Taxonomy

Description	belongs to the class of organic compounds known as tocopherols. These are vitamin E derivatives containing a saturated trimethyltridecyl chain attached to the carbon C6 atom of a benzopyran ring system. The differ from tocotrienols that contain an unsaturated trimethyltrideca-3,7,11-trien-1-yl chain.
Kingdom	Organic compounds
Super Class	Lipids and lipid-like molecules
Class	Prenol lipids
Sub Class	Quinone and hydroquinone lipids
Direct Parent	Tocopherols
Alternative Parents	Diterpenoids 1-benzopyrans Alkyl aryl ethers 1-hydroxy-2-unsubstituted benzenoids Oxacyclic compounds Hydrocarbon derivatives

Publications with beta-Tocopherol

ID	Title	First author	Authors	Year	Journal	Volume	Issue	Pages	PubMed ID	DOI	Study design	No. of Biomarkers	No. of Intake values	No. of Concentration values	No. of Reproducibility values	No. of Correlation values	No. of Metabolomic associations	No. of Microbiota associations	No. of Cancer associations

Biomarker data

Measurements of beta-Tocopherol in biospecimens

Concentration values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Reproducibility values

ID	Excretion ID	Subject group	Population	Country	Cohort	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Arithmetic mean	Geometric mean	Median	Unit	Adjusted on	Reproducibility size	ICC	ICC 95% CI lower	ICC 95% CI upper	CV% WS	CV% BS	VAR WS	VAR BS	Publication

Associations of beta-Tocopherol with exposures

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication

Metabolomic associations

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	Intake Assessment method	Intake	Intervention dose	Biospecimen	Analytical method	Biomarker	Structural identification	Feature selection	Area under curve	Sensitivity	Specificity	PLS-DA VIP	Beta coefficient	Beta coefficient p-value	ANOVA p-value	Publication

Microbiota associations

ID	Biomarker	Experimental evidence	Organism	Biospecimen	Antibiotic	Bacterial source	Substrate	Publication

Associations of beta-Tocopherol with cancer risk

Cancer associations

ID	Excretion ID	Subject group	Population	Country	Cohort	No. of subjects	No. of cases	No. of controls	Biospecimen	Analytical method	Biomarker	Biomarker detail	Cancer	Study design	Publication

Exposure data

Measurements of beta-Tocopherol exposures in populations

Intake values

ID	Parent ID	Depth	Subject group	Population	Country	Cohort	Intake Time definition	Intake assessment tool	Intake food coverage	Intake time coverage	Intake Assessment method	Intake	Intake detail	Food description	Supplement intakes included?	Measurement size	Detected (nb)	Detected (%)	Detected only?	Arithmethic mean	Arithmethic SD	Geometric mean	Geometric SD	Min	Min (detected)	Percentile_05	Percentile_10	Percentile_25	Median	Percentile_75	Percentile_90	Percentile_95	Max	Interquartile range	Mean 95% CI lower	Mean 95% CI upper	GMean 95% CI lower	GMean 95% CI upper	Unit	Converted arithmetic mean	Converted geometric mean	Converted median	Converted unit	Adjustment type	Adjusted on	Regressed on	Expressed as	Publication

Associations of beta-Tocopherol exposures with biomarkers

Correlation values

ID	Intake ID	Excretion ID	Subject group	Population	Country	Cohort	Intake Time definition	Intake Assessment method	Intake	Intake detail	Supplement intakes included?	Intake Arithmetic mean	Intake Geometric mean	Intake Median	Intake Unit	Intake Adjusted on	Biomarker Time definition	Biospecimen	Analytical method	Biomarker	Biomarker detail	Biomarker Arithmetic mean	Biomarker Geometric mean	Biomarker Median	Biomarker Unit	Biomarker Adjusted on	Correlation size	Correlation type	Correlation value	Correlation 95% CI lower	Correlation 95% CI upper	Correlation p-value	Significant?	Measurement adjustment	Deattenuated?	Covariates	Publication