1,2,3,4,6,7,8-HpCDD (Compound)
Go to Compound classification| ID | 916 |
|---|---|
| Name | 1,2,3,4,6,7,8-HpCDD |
| Synonyms | 1,2,3,4,6,7,8-Heptachlorodibenzo-p-dioxin |
| Structure |  |
| Description | |
| Classification | Compounds > Chemical entities > Organic compounds > Organoheterocyclic compounds > Benzodioxins > Benzo-p-dioxins > Dibenzo-p-dioxins > Chlorinated dibenzo-p-dioxins |
| CAS number | 35822-46-9 |
| PubChem ID | 37270 |
| ChEBI ID | 81505 |
| FooDB ID | |
| HMDB ID |
Chemical data
MolDBi data
| IUPAC Name | 1,2,3,4,6,7,8-heptachlorooxanthrene |
|---|---|
| Traditional IUPAC Name | heptachlorodibenzo-P-dioxin |
| Formula | C12HCl7O2 |
| InChI | InChI=1S/C12HCl7O2/c13-2-1-3-10(7(17)4(2)14)21-12-9(19)6(16)5(15)8(18)11(12)20-3/h1H |
| InChI Key | WCLNVRQZUKYVAI-UHFFFAOYSA-N |
| Molecular weight | 425.306 |
| Exact mass | 421.779623225 |
| SMILES | ClC1=CC2=C(OC3=C(Cl)C(Cl)=C(Cl)C(Cl)=C3O2)C(Cl)=C1Cl |
ClassyFire Taxonomy
| Description | belongs to the class of organic compounds known as chlorinated dibenzo-p-dioxins. These are organic compounds containing a chlorine atom attached to a dibenzo-p-dioxin moiety. |
|---|---|
| Kingdom | Organic compounds |
| Super Class | Organoheterocyclic compounds |
| Class | Benzodioxins |
| Sub Class | Benzo-p-dioxins |
| Direct Parent | Chlorinated dibenzo-p-dioxins |
| Alternative Parents |